C21H25N7O4S2 — CID 91428630
N'-hydroxy-2-[4-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-1-yl]sulfonylisoindole-5-carboximidamide (PubChem CID 91428630) has the molecular formula C21H25N7O4S2 and a molecular weight of 503.61 g/mol. Its IUPAC name is N'-hydroxy-2-[4-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-1-yl]sulfonylisoindole-5-carboximidamide.
| Compound Name | N'-hydroxy-2-[4-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-1-yl]sulfonylisoindole-5-carboximidamide |
|---|---|
| PubChem CID | 91428630 |
| Molecular Formula | C21H25N7O4S2 |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | N'-hydroxy-2-[4-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-1-yl]sulfonylisoindole-5-carboximidamide |
| SMILES | CC1Cc2nc(C(=O)N3CCN(S(=O)(=O)n4cc5ccc(C(N)=NO)cc5c4)CC3)sc2CN1 |
| InChI | InChI=1S/C21H25N7O4S2/c1-13-8-17-18(10-23-13)33-20(24-17)21(29)26-4-6-27(7-5-26)34(31,32)28-11-15-3-2-14(19(22)25-30)9-16(15)12-28/h2-3,9,11-13,23,30H,4-8,10H2,1H3,(H2,22,25) |
| InChIKey | HMSDLFDVXCHDEO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 146.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|