C29H34N6O7S2 — CID 22710747
ethyl 2-[4-[6-[(E)-N'-methoxycarbonylcarbamimidoyl]naphthalen-2-yl]sulfonyl-1-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-2-yl]acetate (PubChem CID 22710747) has the molecular formula C29H34N6O7S2 and a molecular weight of 642.76 g/mol. Its IUPAC name is ethyl 2-[4-[6-[(E)-N'-methoxycarbonylcarbamimidoyl]naphthalen-2-yl]sulfonyl-1-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-2-yl]acetate.
| Compound Name | ethyl 2-[4-[6-[(E)-N'-methoxycarbonylcarbamimidoyl]naphthalen-2-yl]sulfonyl-1-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 22710747 |
| Molecular Formula | C29H34N6O7S2 |
| Molecular Weight | 642.76 g/mol |
| Exact Mass | 642.19 |
| IUPAC Name | ethyl 2-[4-[6-[(E)-N'-methoxycarbonylcarbamimidoyl]naphthalen-2-yl]sulfonyl-1-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-2-yl]acetate |
| SMILES | CCOC(=O)CC1CN(S(=O)(=O)c2ccc3cc(/C(N)=N\C(=O)OC)ccc3c2)CCN1C(=O)c1nc2c(s1)CNC(C)C2 |
| InChI | InChI=1S/C29H34N6O7S2/c1-4-42-25(36)14-21-16-34(9-10-35(21)28(37)27-32-23-11-17(2)31-15-24(23)43-27)44(39,40)22-8-7-18-12-20(6-5-19(18)13-22)26(30)33-29(38)41-3/h5-8,12-13,17,21,31H,4,9-11,14-16H2,1-3H3,(H2,30,33,38) |
| InChIKey | KVBGVDVWPQFDTL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 173.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.76 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|