C26H30ClN5O5S2 — CID 22709769
4-(6-chloronaphthalen-2-yl)sulfonyl-N-(2-methoxyethyl)-1-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazine-2-carboxamide (PubChem CID 22709769) has the molecular formula C26H30ClN5O5S2 and a molecular weight of 592.14 g/mol. Its IUPAC name is 4-(6-chloronaphthalen-2-yl)sulfonyl-N-(2-methoxyethyl)-1-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazine-2-carboxamide.
| Compound Name | 4-(6-chloronaphthalen-2-yl)sulfonyl-N-(2-methoxyethyl)-1-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 22709769 |
| Molecular Formula | C26H30ClN5O5S2 |
| Molecular Weight | 592.14 g/mol |
| Exact Mass | 591.14 |
| IUPAC Name | 4-(6-chloronaphthalen-2-yl)sulfonyl-N-(2-methoxyethyl)-1-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazine-2-carboxamide |
| SMILES | COCCNC(=O)C1CN(S(=O)(=O)c2ccc3cc(Cl)ccc3c2)CCN1C(=O)c1nc2c(s1)CNC(C)C2 |
| InChI | InChI=1S/C26H30ClN5O5S2/c1-16-11-21-23(14-29-16)38-25(30-21)26(34)32-9-8-31(15-22(32)24(33)28-7-10-37-2)39(35,36)20-6-4-17-12-19(27)5-3-18(17)13-20/h3-6,12-13,16,22,29H,7-11,14-15H2,1-2H3,(H,28,33) |
| InChIKey | KFWOJKVEXHJYOZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.14 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|