C24H26N6O4S2 — CID 22710150
2-[4-(5-ethynylisoindol-2-yl)sulfonyl-1-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-2-yl]acetamide (PubChem CID 22710150) has the molecular formula C24H26N6O4S2 and a molecular weight of 526.64 g/mol. Its IUPAC name is 2-[4-(5-ethynylisoindol-2-yl)sulfonyl-1-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-2-yl]acetamide.
| Compound Name | 2-[4-(5-ethynylisoindol-2-yl)sulfonyl-1-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 22710150 |
| Molecular Formula | C24H26N6O4S2 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | 2-[4-(5-ethynylisoindol-2-yl)sulfonyl-1-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-2-yl]acetamide |
| SMILES | C#Cc1ccc2cn(S(=O)(=O)N3CCN(C(=O)c4nc5c(s4)CNC(C)C5)C(CC(N)=O)C3)cc2c1 |
| InChI | InChI=1S/C24H26N6O4S2/c1-3-16-4-5-17-12-29(13-18(17)9-16)36(33,34)28-6-7-30(19(14-28)10-22(25)31)24(32)23-27-20-8-15(2)26-11-21(20)35-23/h1,4-5,9,12-13,15,19,26H,6-8,10-11,14H2,2H3,(H2,25,31) |
| InChIKey | ZWPMBNZQRUJJAU-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 130.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|