C23H26N6O5S3 — CID 22710798
[4-[(5-ethynyl-1H-indol-2-yl)sulfonyl]-1-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-2-yl]methanesulfonamide (PubChem CID 22710798) has the molecular formula C23H26N6O5S3 and a molecular weight of 562.70 g/mol. Its IUPAC name is [4-[(5-ethynyl-1H-indol-2-yl)sulfonyl]-1-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-2-yl]methanesulfonamide.
| Compound Name | [4-[(5-ethynyl-1H-indol-2-yl)sulfonyl]-1-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 22710798 |
| Molecular Formula | C23H26N6O5S3 |
| Molecular Weight | 562.70 g/mol |
| Exact Mass | 562.11 |
| IUPAC Name | [4-[(5-ethynyl-1H-indol-2-yl)sulfonyl]-1-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-2-yl]methanesulfonamide |
| SMILES | C#Cc1ccc2[nH]c(S(=O)(=O)N3CCN(C(=O)c4nc5c(s4)CNC(C)C5)C(CS(N)(=O)=O)C3)cc2c1 |
| InChI | InChI=1S/C23H26N6O5S3/c1-3-15-4-5-18-16(9-15)10-21(26-18)37(33,34)28-6-7-29(17(12-28)13-36(24,31)32)23(30)22-27-19-8-14(2)25-11-20(19)35-22/h1,4-5,9-10,14,17,25-26H,6-8,11-13H2,2H3,(H2,24,31,32) |
| InChIKey | VMTSWAKSXWWLAP-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 158.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.70 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|