C24H29N7O5S2 — CID 22709604
ethyl 4-[(5-carbamimidoyl-1H-indol-2-yl)sulfonyl]-1-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazine-2-carboxylate (PubChem CID 22709604) has the molecular formula C24H29N7O5S2 and a molecular weight of 559.67 g/mol. Its IUPAC name is ethyl 4-[(5-carbamimidoyl-1H-indol-2-yl)sulfonyl]-1-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazine-2-carboxylate.
| Compound Name | ethyl 4-[(5-carbamimidoyl-1H-indol-2-yl)sulfonyl]-1-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 22709604 |
| Molecular Formula | C24H29N7O5S2 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | ethyl 4-[(5-carbamimidoyl-1H-indol-2-yl)sulfonyl]-1-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazine-2-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc2[nH]c(S(=O)(=O)N3CCN(C(=O)c4nc5c(s4)CNC(C)C5)C(C(=O)OCC)C3)cc2c1 |
| InChI | InChI=1S/C24H29N7O5S2/c1-3-36-24(33)18-12-30(38(34,35)20-10-15-9-14(21(25)26)4-5-16(15)28-20)6-7-31(18)23(32)22-29-17-8-13(2)27-11-19(17)37-22/h4-5,9-10,13,18,27-28H,3,6-8,11-12H2,1-2H3,(H3,25,26) |
| InChIKey | NXVQAFKHLUCWMI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 174.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|