C26H32N8O6S2 — CID 22711469
methyl (NE)-N-[amino-[2-[3-[2-(methylamino)-2-oxoethyl]-4-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-1-yl]sulfonyl-1H-indol-6-yl]methylidene]carbamate (PubChem CID 22711469) has the molecular formula C26H32N8O6S2 and a molecular weight of 616.73 g/mol. Its IUPAC name is methyl (NE)-N-[amino-[2-[3-[2-(methylamino)-2-oxoethyl]-4-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-1-yl]sulfonyl-1H-indol-6-yl]methylidene]carbamate.
| Compound Name | methyl (NE)-N-[amino-[2-[3-[2-(methylamino)-2-oxoethyl]-4-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-1-yl]sulfonyl-1H-indol-6-yl]methylidene]carbamate |
|---|---|
| PubChem CID | 22711469 |
| Molecular Formula | C26H32N8O6S2 |
| Molecular Weight | 616.73 g/mol |
| Exact Mass | 616.19 |
| IUPAC Name | methyl (NE)-N-[amino-[2-[3-[2-(methylamino)-2-oxoethyl]-4-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)piperazin-1-yl]sulfonyl-1H-indol-6-yl]methylidene]carbamate |
| SMILES | CNC(=O)CC1CN(S(=O)(=O)c2cc3ccc(/C(N)=N\C(=O)OC)cc3[nH]2)CCN1C(=O)c1nc2c(s1)CNC(C)C2 |
| InChI | InChI=1S/C26H32N8O6S2/c1-14-8-19-20(12-29-14)41-24(31-19)25(36)34-7-6-33(13-17(34)11-21(35)28-2)42(38,39)22-10-15-4-5-16(9-18(15)30-22)23(27)32-26(37)40-3/h4-5,9-10,14,17,29-30H,6-8,11-13H2,1-3H3,(H,28,35)(H2,27,32,37) |
| InChIKey | PSPVHEZJTRVSQS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 192.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.73 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|