C23H27N11O3S2 — CID 22711212
2-[4-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)-3-(2H-tetrazol-5-ylmethyl)piperazin-1-yl]sulfonylisoindole-5-carboximidamide (PubChem CID 22711212) has the molecular formula C23H27N11O3S2 and a molecular weight of 569.68 g/mol. Its IUPAC name is 2-[4-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)-3-(2H-tetrazol-5-ylmethyl)piperazin-1-yl]sulfonylisoindole-5-carboximidamide.
| Compound Name | 2-[4-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)-3-(2H-tetrazol-5-ylmethyl)piperazin-1-yl]sulfonylisoindole-5-carboximidamide |
|---|---|
| PubChem CID | 22711212 |
| Molecular Formula | C23H27N11O3S2 |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | 2-[4-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)-3-(2H-tetrazol-5-ylmethyl)piperazin-1-yl]sulfonylisoindole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2cn(S(=O)(=O)N3CCN(C(=O)c4nc5c(s4)CNC(C)C5)C(Cc4nn[nH]n4)C3)cc2c1 |
| InChI | InChI=1S/C23H27N11O3S2/c1-13-6-18-19(9-26-13)38-22(27-18)23(35)34-5-4-32(12-17(34)8-20-28-30-31-29-20)39(36,37)33-10-15-3-2-14(21(24)25)7-16(15)11-33/h2-3,7,10-11,13,17,26H,4-6,8-9,12H2,1H3,(H3,24,25)(H,28,29,30,31) |
| InChIKey | JPHLZBAWCDJGBQ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 191.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|