C20H21ClN4O3S3 — CID 22710957
[4-[(5-chloro-1-benzothiophen-2-yl)sulfonyl]piperazin-1-yl]-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)methanone (PubChem CID 22710957) has the molecular formula C20H21ClN4O3S3 and a molecular weight of 497.07 g/mol. Its IUPAC name is [4-[(5-chloro-1-benzothiophen-2-yl)sulfonyl]piperazin-1-yl]-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)methanone.
| Compound Name | [4-[(5-chloro-1-benzothiophen-2-yl)sulfonyl]piperazin-1-yl]-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)methanone |
|---|---|
| PubChem CID | 22710957 |
| Molecular Formula | C20H21ClN4O3S3 |
| Molecular Weight | 497.07 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | [4-[(5-chloro-1-benzothiophen-2-yl)sulfonyl]piperazin-1-yl]-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)methanone |
| SMILES | CC1Cc2nc(C(=O)N3CCN(S(=O)(=O)c4cc5cc(Cl)ccc5s4)CC3)sc2CN1 |
| InChI | InChI=1S/C20H21ClN4O3S3/c1-12-8-15-17(11-22-12)30-19(23-15)20(26)24-4-6-25(7-5-24)31(27,28)18-10-13-9-14(21)2-3-16(13)29-18/h2-3,9-10,12,22H,4-8,11H2,1H3 |
| InChIKey | LAIDDWRTUBXNSZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.07 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |