C24H25ClN6O4S4 — CID 91469079
[4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]-2-[2-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)ethyl]piperazin-1-yl]-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)methanone (PubChem CID 91469079) has the molecular formula C24H25ClN6O4S4 and a molecular weight of 625.22 g/mol. Its IUPAC name is [4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]-2-[2-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)ethyl]piperazin-1-yl]-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)methanone.
| Compound Name | [4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]-2-[2-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)ethyl]piperazin-1-yl]-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)methanone |
|---|---|
| PubChem CID | 91469079 |
| Molecular Formula | C24H25ClN6O4S4 |
| Molecular Weight | 625.22 g/mol |
| Exact Mass | 624.05 |
| IUPAC Name | [4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]-2-[2-(5-sulfanylidene-2H-1,2,4-oxadiazol-3-yl)ethyl]piperazin-1-yl]-(6-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)methanone |
| SMILES | CC1Cc2nc(C(=O)N3CCN(S(=O)(=O)c4cc5ccc(Cl)cc5s4)CC3CCc3nc(=S)o[nH]3)sc2CN1 |
| InChI | InChI=1S/C24H25ClN6O4S4/c1-13-8-17-19(11-26-13)38-22(27-17)23(32)31-7-6-30(12-16(31)4-5-20-28-24(36)35-29-20)39(33,34)21-9-14-2-3-15(25)10-18(14)37-21/h2-3,9-10,13,16,26H,4-8,11-12H2,1H3,(H,28,29,36) |
| InChIKey | XYGFOKCRJWUYHD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 124.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.22 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|