C24H27ClN4O5S3 — CID 22711303
tert-butyl 2-[4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]piperazine-1-carbonyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-6-carboxylate (PubChem CID 22711303) has the molecular formula C24H27ClN4O5S3 and a molecular weight of 583.16 g/mol. Its IUPAC name is tert-butyl 2-[4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]piperazine-1-carbonyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-6-carboxylate.
| Compound Name | tert-butyl 2-[4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]piperazine-1-carbonyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 22711303 |
| Molecular Formula | C24H27ClN4O5S3 |
| Molecular Weight | 583.16 g/mol |
| Exact Mass | 582.08 |
| IUPAC Name | tert-butyl 2-[4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]piperazine-1-carbonyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1Cc2nc(C(=O)N3CCN(S(=O)(=O)c4cc5ccc(Cl)cc5s4)CC3)sc2CN1 |
| InChI | InChI=1S/C24H27ClN4O5S3/c1-24(2,3)34-23(31)17-12-16-19(13-26-17)36-21(27-16)22(30)28-6-8-29(9-7-28)37(32,33)20-10-14-4-5-15(25)11-18(14)35-20/h4-5,10-11,17,26H,6-9,12-13H2,1-3H3 |
| InChIKey | DHRBTLNFDBQKCX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.16 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |