C21H21N5O3S3 — CID 22710061
(6-amino-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-[4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]piperazin-1-yl]methanone (PubChem CID 22710061) has the molecular formula C21H21N5O3S3 and a molecular weight of 487.63 g/mol. Its IUPAC name is (6-amino-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-[4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]piperazin-1-yl]methanone.
| Compound Name | (6-amino-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-[4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 22710061 |
| Molecular Formula | C21H21N5O3S3 |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | (6-amino-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-[4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]piperazin-1-yl]methanone |
| SMILES | C#Cc1ccc2cc(S(=O)(=O)N3CCN(C(=O)c4nc5c(s4)CNC(N)C5)CC3)sc2c1 |
| InChI | InChI=1S/C21H21N5O3S3/c1-2-13-3-4-14-10-19(30-16(14)9-13)32(28,29)26-7-5-25(6-8-26)21(27)20-24-15-11-18(22)23-12-17(15)31-20/h1,3-4,9-10,18,23H,5-8,11-12,22H2 |
| InChIKey | DJMMBNSLSOPFSO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|