C18H27ClN2O2 — CID 139898287
N-[[4-[2-(1,3-oxazol-2-yl)ethoxy]phenyl]methyl]hexan-1-amine;hydrochloride (PubChem CID 139898287) has the molecular formula C18H27ClN2O2 and a molecular weight of 338.88 g/mol. Its IUPAC name is N-[[4-[2-(1,3-oxazol-2-yl)ethoxy]phenyl]methyl]hexan-1-amine;hydrochloride.
| Compound Name | N-[[4-[2-(1,3-oxazol-2-yl)ethoxy]phenyl]methyl]hexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 139898287 |
| Molecular Formula | C18H27ClN2O2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | N-[[4-[2-(1,3-oxazol-2-yl)ethoxy]phenyl]methyl]hexan-1-amine;hydrochloride |
| SMILES | CCCCCCNCc1ccc(OCCc2ncco2)cc1.Cl |
| InChI | InChI=1S/C18H26N2O2.ClH/c1-2-3-4-5-11-19-15-16-6-8-17(9-7-16)21-13-10-18-20-12-14-22-18;/h6-9,12,14,19H,2-5,10-11,13,15H2,1H3;1H |
| InChIKey | ZWSNVGBAVCPOJO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|