C24H30O4S2 — CID 139902125
2-[2-[10-[2-(2-hydroxyethylsulfanyl)ethoxy]-2,3-dimethylanthracen-9-yl]oxyethylsulfanyl]ethanol (PubChem CID 139902125) has the molecular formula C24H30O4S2 and a molecular weight of 446.63 g/mol. Its IUPAC name is 2-[2-[10-[2-(2-hydroxyethylsulfanyl)ethoxy]-2,3-dimethylanthracen-9-yl]oxyethylsulfanyl]ethanol.
| Compound Name | 2-[2-[10-[2-(2-hydroxyethylsulfanyl)ethoxy]-2,3-dimethylanthracen-9-yl]oxyethylsulfanyl]ethanol |
|---|---|
| PubChem CID | 139902125 |
| Molecular Formula | C24H30O4S2 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 2-[2-[10-[2-(2-hydroxyethylsulfanyl)ethoxy]-2,3-dimethylanthracen-9-yl]oxyethylsulfanyl]ethanol |
| SMILES | Cc1cc2c(OCCSCCO)c3ccccc3c(OCCSCCO)c2cc1C |
| InChI | InChI=1S/C24H30O4S2/c1-17-15-21-22(16-18(17)2)24(28-10-14-30-12-8-26)20-6-4-3-5-19(20)23(21)27-9-13-29-11-7-25/h3-6,15-16,25-26H,7-14H2,1-2H3 |
| InChIKey | JXVWGASVSHKKBW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|