C15H23N2NaO2 — CID 139905838
sodium (tert-butylamino)-[2-(tert-butylcarbamoyl)cyclopenta-2,4-dien-1-ylidene]methanolate (PubChem CID 139905838) has the molecular formula C15H23N2NaO2 and a molecular weight of 286.35 g/mol. Its IUPAC name is sodium (tert-butylamino)-[2-(tert-butylcarbamoyl)cyclopenta-2,4-dien-1-ylidene]methanolate.
| Compound Name | sodium (tert-butylamino)-[2-(tert-butylcarbamoyl)cyclopenta-2,4-dien-1-ylidene]methanolate |
|---|---|
| PubChem CID | 139905838 |
| Molecular Formula | C15H23N2NaO2 |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | sodium (tert-butylamino)-[2-(tert-butylcarbamoyl)cyclopenta-2,4-dien-1-ylidene]methanolate |
| SMILES | CC(C)(C)NC(=O)C1=CC=CC1=C([O-])NC(C)(C)C.[Na+] |
| InChI | InChI=1S/C15H24N2O2.Na/c1-14(2,3)16-12(18)10-8-7-9-11(10)13(19)17-15(4,5)6;/h7-9,16,18H,1-6H3,(H,17,19);/q;+1/p-1 |
| InChIKey | RIYKSOAAOYDVOB-UHFFFAOYSA-M |
| XLogP | -1.64 |
| TPSA | 64.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|