C14H21NO — CID 143284559
ethane;(3E)-3-ethylidene-4,5-bis[(Z)-prop-1-enyl]-1H-pyrrol-2-one (PubChem CID 143284559) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is ethane;(3E)-3-ethylidene-4,5-bis[(Z)-prop-1-enyl]-1H-pyrrol-2-one.
| Compound Name | ethane;(3E)-3-ethylidene-4,5-bis[(Z)-prop-1-enyl]-1H-pyrrol-2-one |
|---|---|
| PubChem CID | 143284559 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | ethane;(3E)-3-ethylidene-4,5-bis[(Z)-prop-1-enyl]-1H-pyrrol-2-one |
| SMILES | C/C=C\C1=C(/C=C\C)/C(=C\C)C(=O)N1.CC |
| InChI | InChI=1S/C12H15NO.C2H6/c1-4-7-10-9(6-3)12(14)13-11(10)8-5-2;1-2/h4-8H,1-3H3,(H,13,14);1-2H3/b7-4-,8-5-,9-6+; |
| InChIKey | HPWYNDCNWKFRDP-STDJSBHPSA-N |
| XLogP | 3.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|