C31H46ClN3O3 — CID 139906724
1-[4-[[4-(cyclohexylmethylamino)butylamino]methyl]piperidin-1-yl]-2,2-bis(4-hydroxyphenyl)ethanone;hydrochloride (PubChem CID 139906724) has the molecular formula C31H46ClN3O3 and a molecular weight of 544.18 g/mol. Its IUPAC name is 1-[4-[[4-(cyclohexylmethylamino)butylamino]methyl]piperidin-1-yl]-2,2-bis(4-hydroxyphenyl)ethanone;hydrochloride.
| Compound Name | 1-[4-[[4-(cyclohexylmethylamino)butylamino]methyl]piperidin-1-yl]-2,2-bis(4-hydroxyphenyl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 139906724 |
| Molecular Formula | C31H46ClN3O3 |
| Molecular Weight | 544.18 g/mol |
| Exact Mass | 543.32 |
| IUPAC Name | 1-[4-[[4-(cyclohexylmethylamino)butylamino]methyl]piperidin-1-yl]-2,2-bis(4-hydroxyphenyl)ethanone;hydrochloride |
| SMILES | Cl.O=C(C(c1ccc(O)cc1)c1ccc(O)cc1)N1CCC(CNCCCCNCC2CCCCC2)CC1 |
| InChI | InChI=1S/C31H45N3O3.ClH/c35-28-12-8-26(9-13-28)30(27-10-14-29(36)15-11-27)31(37)34-20-16-25(17-21-34)23-33-19-5-4-18-32-22-24-6-2-1-3-7-24;/h8-15,24-25,30,32-33,35-36H,1-7,16-23H2;1H |
| InChIKey | ZTKKJSUIRPFPAR-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.18 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|