C9H10O — CID 139909293
3-cyclopenta-2,4-dien-1-ylideneoxolane (PubChem CID 139909293) has the molecular formula C9H10O and a molecular weight of 134.18 g/mol. Its IUPAC name is 3-cyclopenta-2,4-dien-1-ylideneoxolane.
| Compound Name | 3-cyclopenta-2,4-dien-1-ylideneoxolane |
|---|---|
| PubChem CID | 139909293 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 3-cyclopenta-2,4-dien-1-ylideneoxolane |
| SMILES | C1=CC(=C2CCOC2)C=C1 |
| InChI | InChI=1S/C9H10O/c1-2-4-8(3-1)9-5-6-10-7-9/h1-4H,5-7H2 |
| InChIKey | VFUWFPOKJCFNDQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |