C8H12O — CID 134860390
3-(2-methylprop-1-enyl)-2,5-dihydrofuran (PubChem CID 134860390) has the molecular formula C8H12O and a molecular weight of 124.18 g/mol. Its IUPAC name is 3-(2-methylprop-1-enyl)-2,5-dihydrofuran.
| Compound Name | 3-(2-methylprop-1-enyl)-2,5-dihydrofuran |
|---|---|
| PubChem CID | 134860390 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | 3-(2-methylprop-1-enyl)-2,5-dihydrofuran |
| SMILES | CC(C)=CC1=CCOC1 |
| InChI | InChI=1S/C8H12O/c1-7(2)5-8-3-4-9-6-8/h3,5H,4,6H2,1-2H3 |
| InChIKey | LSJNNIUKBFHXNI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |