C11H19FO — CID 142309223
(2E,4Z)-1-(2-fluoroethoxy)-2,5-dimethylhepta-2,4-diene (PubChem CID 142309223) has the molecular formula C11H19FO and a molecular weight of 186.27 g/mol. Its IUPAC name is (2E,4Z)-1-(2-fluoroethoxy)-2,5-dimethylhepta-2,4-diene.
| Compound Name | (2E,4Z)-1-(2-fluoroethoxy)-2,5-dimethylhepta-2,4-diene |
|---|---|
| PubChem CID | 142309223 |
| Molecular Formula | C11H19FO |
| Molecular Weight | 186.27 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (2E,4Z)-1-(2-fluoroethoxy)-2,5-dimethylhepta-2,4-diene |
| SMILES | CC/C(C)=C\C=C(/C)COCCF |
| InChI | InChI=1S/C11H19FO/c1-4-10(2)5-6-11(3)9-13-8-7-12/h5-6H,4,7-9H2,1-3H3/b10-5-,11-6+ |
| InChIKey | ABCAJTPHGVTBHH-JZKFVHIFSA-N |
| XLogP | 3.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|