C9H13F5O — CID 91172878
4,4,5,5,5-pentafluoro-3-methyl-1-propoxypent-2-ene (PubChem CID 91172878) has the molecular formula C9H13F5O and a molecular weight of 232.19 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoro-3-methyl-1-propoxypent-2-ene.
| Compound Name | 4,4,5,5,5-pentafluoro-3-methyl-1-propoxypent-2-ene |
|---|---|
| PubChem CID | 91172878 |
| Molecular Formula | C9H13F5O |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 4,4,5,5,5-pentafluoro-3-methyl-1-propoxypent-2-ene |
| SMILES | CCCOCC=C(C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H13F5O/c1-3-5-15-6-4-7(2)8(10,11)9(12,13)14/h4H,3,5-6H2,1-2H3 |
| InChIKey | IEAGHHMWEITZCM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|