C14H15BrCl3NO — CID 139910092
N-[(1R)-1-(4-bromophenyl)ethyl]-2-(1,3,3-trichlorocyclobutyl)acetamide (PubChem CID 139910092) has the molecular formula C14H15BrCl3NO and a molecular weight of 399.54 g/mol. Its IUPAC name is N-[(1R)-1-(4-bromophenyl)ethyl]-2-(1,3,3-trichlorocyclobutyl)acetamide.
| Compound Name | N-[(1R)-1-(4-bromophenyl)ethyl]-2-(1,3,3-trichlorocyclobutyl)acetamide |
|---|---|
| PubChem CID | 139910092 |
| Molecular Formula | C14H15BrCl3NO |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 396.94 |
| IUPAC Name | N-[(1R)-1-(4-bromophenyl)ethyl]-2-(1,3,3-trichlorocyclobutyl)acetamide |
| SMILES | C[C@@H](NC(=O)CC1(Cl)CC(Cl)(Cl)C1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H15BrCl3NO/c1-9(10-2-4-11(15)5-3-10)19-12(20)6-13(16)7-14(17,18)8-13/h2-5,9H,6-8H2,1H3,(H,19,20)/t9-/m1/s1 |
| InChIKey | MJNDFSQRLRGQDL-SECBINFHSA-N |
| XLogP | 4.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|