C13H13BrCl3NO — CID 54457761
N-[(1R)-1-(4-bromophenyl)ethyl]-1,3,3-trichlorocyclobutane-1-carboxamide (PubChem CID 54457761) has the molecular formula C13H13BrCl3NO and a molecular weight of 385.52 g/mol. Its IUPAC name is N-[(1R)-1-(4-bromophenyl)ethyl]-1,3,3-trichlorocyclobutane-1-carboxamide.
| Compound Name | N-[(1R)-1-(4-bromophenyl)ethyl]-1,3,3-trichlorocyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 54457761 |
| Molecular Formula | C13H13BrCl3NO |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 382.92 |
| IUPAC Name | N-[(1R)-1-(4-bromophenyl)ethyl]-1,3,3-trichlorocyclobutane-1-carboxamide |
| SMILES | C[C@@H](NC(=O)C1(Cl)CC(Cl)(Cl)C1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H13BrCl3NO/c1-8(9-2-4-10(14)5-3-9)18-11(19)12(15)6-13(16,17)7-12/h2-5,8H,6-7H2,1H3,(H,18,19)/t8-/m1/s1 |
| InChIKey | WZKWCDRSJRDLPR-MRVPVSSYSA-N |
| XLogP | 4.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|