C13H12F3NO2 — CID 139911320
ethyl 2-(trifluoromethyl)-1,2-dihydroquinoline-3-carboxylate (PubChem CID 139911320) has the molecular formula C13H12F3NO2 and a molecular weight of 271.24 g/mol. Its IUPAC name is ethyl 2-(trifluoromethyl)-1,2-dihydroquinoline-3-carboxylate.
| Compound Name | ethyl 2-(trifluoromethyl)-1,2-dihydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 139911320 |
| Molecular Formula | C13H12F3NO2 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | ethyl 2-(trifluoromethyl)-1,2-dihydroquinoline-3-carboxylate |
| SMILES | CCOC(=O)C1=Cc2ccccc2NC1C(F)(F)F |
| InChI | InChI=1S/C13H12F3NO2/c1-2-19-12(18)9-7-8-5-3-4-6-10(8)17-11(9)13(14,15)16/h3-7,11,17H,2H2,1H3 |
| InChIKey | IVNKFHDUOLSVIR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |