C29H36N2O4 — CID 139911566
(4S)-4-benzyl-3-[(5S)-3-(4-heptylphenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-5,5-dimethyl-1,3-oxazolidin-2-one (PubChem CID 139911566) has the molecular formula C29H36N2O4 and a molecular weight of 476.62 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(5S)-3-(4-heptylphenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-5,5-dimethyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(5S)-3-(4-heptylphenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-5,5-dimethyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139911566 |
| Molecular Formula | C29H36N2O4 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | (4S)-4-benzyl-3-[(5S)-3-(4-heptylphenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-5,5-dimethyl-1,3-oxazolidin-2-one |
| SMILES | CCCCCCCc1ccc(C2=NO[C@H](C(=O)N3C(=O)OC(C)(C)[C@@H]3Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C29H36N2O4/c1-4-5-6-7-9-12-21-15-17-23(18-16-21)24-20-25(35-30-24)27(32)31-26(29(2,3)34-28(31)33)19-22-13-10-8-11-14-22/h8,10-11,13-18,25-26H,4-7,9,12,19-20H2,1-3H3/t25-,26-/m0/s1 |
| InChIKey | VSZBRXNLRVZTDE-UIOOFZCWSA-N |
| XLogP | 6.06 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|