C30H38N2O4 — CID 139911571
(4S)-4-benzyl-5,5-dimethyl-3-[(5S)-3-(4-octylphenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-1,3-oxazolidin-2-one (PubChem CID 139911571) has the molecular formula C30H38N2O4 and a molecular weight of 490.64 g/mol. Its IUPAC name is (4S)-4-benzyl-5,5-dimethyl-3-[(5S)-3-(4-octylphenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-5,5-dimethyl-3-[(5S)-3-(4-octylphenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139911571 |
| Molecular Formula | C30H38N2O4 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | (4S)-4-benzyl-5,5-dimethyl-3-[(5S)-3-(4-octylphenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-1,3-oxazolidin-2-one |
| SMILES | CCCCCCCCc1ccc(C2=NO[C@H](C(=O)N3C(=O)OC(C)(C)[C@@H]3Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C30H38N2O4/c1-4-5-6-7-8-10-13-22-16-18-24(19-17-22)25-21-26(36-31-25)28(33)32-27(30(2,3)35-29(32)34)20-23-14-11-9-12-15-23/h9,11-12,14-19,26-27H,4-8,10,13,20-21H2,1-3H3/t26-,27-/m0/s1 |
| InChIKey | YFQADQVOKPLPNY-SVBPBHIXSA-N |
| XLogP | 6.45 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|