About 5-ethyl-2,8-dimethyl-15-propan-2-yloctadecane
5-ethyl-2,8-dimethyl-15-propan-2-yloctadecane (PubChem CID 139911730) has the molecular formula C25H52
and a molecular weight of 352.69 g/mol. Its IUPAC name is 5-ethyl-2,8-dimethyl-15-propan-2-yloctadecane.
Molecular Properties
| Compound Name | 5-ethyl-2,8-dimethyl-15-propan-2-yloctadecane |
| PubChem CID | 139911730 |
| Molecular Formula | C25H52 |
| Molecular Weight | 352.69 g/mol |
| Exact Mass | 352.41 |
| IUPAC Name | 5-ethyl-2,8-dimethyl-15-propan-2-yloctadecane |
| SMILES | CCCC(CCCCCCC(C)CCC(CC)CCC(C)C)C(C)C |
| InChI | InChI=1S/C25H52/c1-8-14-25(22(5)6)16-13-11-10-12-15-23(7)18-20-24(9-2)19-17-21(3)4/h21-25H,8-20H2,1-7H3 |
| InChIKey | UIDWLZWYDLTXJK-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.69 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-2,8-dimethyl-15-propan-2-yloctadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2,8-dimethyl-15-propan-2-yloctadecane?
The IUPAC name of 5-ethyl-2,8-dimethyl-15-propan-2-yloctadecane (CID 139911730) is 5-ethyl-2,8-dimethyl-15-propan-2-yloctadecane.
What is the SMILES notation for 5-ethyl-2,8-dimethyl-15-propan-2-yloctadecane?
The canonical SMILES for 5-ethyl-2,8-dimethyl-15-propan-2-yloctadecane is CCCC(CCCCCCC(C)CCC(CC)CCC(C)C)C(C)C.
What is the InChIKey of 5-ethyl-2,8-dimethyl-15-propan-2-yloctadecane?
The InChIKey is UIDWLZWYDLTXJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H52/c1-8-14-25(22(5)6)16-13-11-10-12-15-23(7)18-20-24(9-2)19-17-21(3)4/h21-25H,8-20H2,1-7H3.
What are the key properties of 5-ethyl-2,8-dimethyl-15-propan-2-yloctadecane?
5-ethyl-2,8-dimethyl-15-propan-2-yloctadecane has a molecular weight of 352.69 g/mol, XLogP of 9.28, 17 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2,8-dimethyl-15-propan-2-yloctadecane is sourced from PubChem (CID 139911730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).