C20H23BrFN3O — CID 139912851
2-bromo-N-[[4-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]phenyl]methyl]acetamide (PubChem CID 139912851) has the molecular formula C20H23BrFN3O and a molecular weight of 420.33 g/mol. Its IUPAC name is 2-bromo-N-[[4-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]phenyl]methyl]acetamide.
| Compound Name | 2-bromo-N-[[4-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 139912851 |
| Molecular Formula | C20H23BrFN3O |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 2-bromo-N-[[4-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]phenyl]methyl]acetamide |
| SMILES | O=C(CBr)NCc1ccc(CN2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H23BrFN3O/c21-13-20(26)23-14-16-1-3-17(4-2-16)15-24-9-11-25(12-10-24)19-7-5-18(22)6-8-19/h1-8H,9-15H2,(H,23,26) |
| InChIKey | SJMQPODZUGWFBM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|