C21H27NO4S — CID 139912875
ethyl 4-[2-(1-benzothiophen-2-yl)propanoylamino]-4,5-dimethyl-3-oxohexanoate (PubChem CID 139912875) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is ethyl 4-[2-(1-benzothiophen-2-yl)propanoylamino]-4,5-dimethyl-3-oxohexanoate.
| Compound Name | ethyl 4-[2-(1-benzothiophen-2-yl)propanoylamino]-4,5-dimethyl-3-oxohexanoate |
|---|---|
| PubChem CID | 139912875 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | ethyl 4-[2-(1-benzothiophen-2-yl)propanoylamino]-4,5-dimethyl-3-oxohexanoate |
| SMILES | CCOC(=O)CC(=O)C(C)(NC(=O)C(C)c1cc2ccccc2s1)C(C)C |
| InChI | InChI=1S/C21H27NO4S/c1-6-26-19(24)12-18(23)21(5,13(2)3)22-20(25)14(4)17-11-15-9-7-8-10-16(15)27-17/h7-11,13-14H,6,12H2,1-5H3,(H,22,25) |
| InChIKey | UGLOBNNCOYNKSL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|