C15H20N2O4 — CID 1399143
1-[2-(cyclohexen-1-yl)ethyl]-6-hydroxy-5-propanoylpyrimidine-2,4-dione (PubChem CID 1399143) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-6-hydroxy-5-propanoylpyrimidine-2,4-dione.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-6-hydroxy-5-propanoylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 1399143 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-6-hydroxy-5-propanoylpyrimidine-2,4-dione |
| SMILES | CCC(=O)c1c(O)n(CCC2=CCCCC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H20N2O4/c1-2-11(18)12-13(19)16-15(21)17(14(12)20)9-8-10-6-4-3-5-7-10/h6,20H,2-5,7-9H2,1H3,(H,16,19,21) |
| InChIKey | MQGBPMIBZCMESU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|