C20H26FNO4 — CID 139917494
tert-butyl 3-[[(2S,5S)-1-ethynyl-5-(2-hydroxyethyl)pyrrolidin-2-yl]methoxy]-2-fluorobenzoate (PubChem CID 139917494) has the molecular formula C20H26FNO4 and a molecular weight of 363.43 g/mol. Its IUPAC name is tert-butyl 3-[[(2S,5S)-1-ethynyl-5-(2-hydroxyethyl)pyrrolidin-2-yl]methoxy]-2-fluorobenzoate.
| Compound Name | tert-butyl 3-[[(2S,5S)-1-ethynyl-5-(2-hydroxyethyl)pyrrolidin-2-yl]methoxy]-2-fluorobenzoate |
|---|---|
| PubChem CID | 139917494 |
| Molecular Formula | C20H26FNO4 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | tert-butyl 3-[[(2S,5S)-1-ethynyl-5-(2-hydroxyethyl)pyrrolidin-2-yl]methoxy]-2-fluorobenzoate |
| SMILES | C#CN1[C@H](CCO)CC[C@H]1COc1cccc(C(=O)OC(C)(C)C)c1F |
| InChI | InChI=1S/C20H26FNO4/c1-5-22-14(11-12-23)9-10-15(22)13-25-17-8-6-7-16(18(17)21)19(24)26-20(2,3)4/h1,6-8,14-15,23H,9-13H2,2-4H3/t14-,15-/m0/s1 |
| InChIKey | XQJFNOKAXNUVHZ-GJZGRUSLSA-N |
| XLogP | 2.97 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|