C25H27F6N2O3+ — CID 139917728
8-[2-[bis[3-(trifluoromethyl)phenyl]methoxy]ethyl]-8-methyl-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one (PubChem CID 139917728) has the molecular formula C25H27F6N2O3+ and a molecular weight of 517.49 g/mol. Its IUPAC name is 8-[2-[bis[3-(trifluoromethyl)phenyl]methoxy]ethyl]-8-methyl-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one.
| Compound Name | 8-[2-[bis[3-(trifluoromethyl)phenyl]methoxy]ethyl]-8-methyl-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 139917728 |
| Molecular Formula | C25H27F6N2O3+ |
| Molecular Weight | 517.49 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | 8-[2-[bis[3-(trifluoromethyl)phenyl]methoxy]ethyl]-8-methyl-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one |
| SMILES | C[N+]1(CCOC(c2cccc(C(F)(F)F)c2)c2cccc(C(F)(F)F)c2)CCC2(CC1)CNC(=O)O2 |
| InChI | InChI=1S/C25H26F6N2O3/c1-33(10-8-23(9-11-33)16-32-22(34)36-23)12-13-35-21(17-4-2-6-19(14-17)24(26,27)28)18-5-3-7-20(15-18)25(29,30)31/h2-7,14-15,21H,8-13,16H2,1H3/p+1 |
| InChIKey | WFMBTKAOEVSKMW-UHFFFAOYSA-O |
| XLogP | 5.55 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|