C29H34F6N2O5 — CID 139975859
8-[3-[bis[3-(trifluoromethyl)phenyl]methoxy]propyl]-3-(2-methoxyethoxymethyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one (PubChem CID 139975859) has the molecular formula C29H34F6N2O5 and a molecular weight of 604.59 g/mol. Its IUPAC name is 8-[3-[bis[3-(trifluoromethyl)phenyl]methoxy]propyl]-3-(2-methoxyethoxymethyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 8-[3-[bis[3-(trifluoromethyl)phenyl]methoxy]propyl]-3-(2-methoxyethoxymethyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 139975859 |
| Molecular Formula | C29H34F6N2O5 |
| Molecular Weight | 604.59 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | 8-[3-[bis[3-(trifluoromethyl)phenyl]methoxy]propyl]-3-(2-methoxyethoxymethyl)-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
| SMILES | COCCOCN1CC2(CCN(CCCOC(c3cccc(C(F)(F)F)c3)c3cccc(C(F)(F)F)c3)CC2)OC1=O |
| InChI | InChI=1S/C29H34F6N2O5/c1-39-15-16-40-20-37-19-27(42-26(37)38)9-12-36(13-10-27)11-4-14-41-25(21-5-2-7-23(17-21)28(30,31)32)22-6-3-8-24(18-22)29(33,34)35/h2-3,5-8,17-18,25H,4,9-16,19-20H2,1H3 |
| InChIKey | KCTUZEJYGGEXJA-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.59 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|