C26H24N2O3 — CID 139917947
N-[2-[2-(2-hydroxyphenyl)phenyl]-4-phenyl-1,3-oxazol-5-yl]pentanamide (PubChem CID 139917947) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[2-[2-(2-hydroxyphenyl)phenyl]-4-phenyl-1,3-oxazol-5-yl]pentanamide.
| Compound Name | N-[2-[2-(2-hydroxyphenyl)phenyl]-4-phenyl-1,3-oxazol-5-yl]pentanamide |
|---|---|
| PubChem CID | 139917947 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | N-[2-[2-(2-hydroxyphenyl)phenyl]-4-phenyl-1,3-oxazol-5-yl]pentanamide |
| SMILES | CCCCC(=O)Nc1oc(-c2ccccc2-c2ccccc2O)nc1-c1ccccc1 |
| InChI | InChI=1S/C26H24N2O3/c1-2-3-17-23(30)27-26-24(18-11-5-4-6-12-18)28-25(31-26)21-15-8-7-13-19(21)20-14-9-10-16-22(20)29/h4-16,29H,2-3,17H2,1H3,(H,27,30) |
| InChIKey | ODGKNBPVTQVEAZ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |