C26H24N2O3S — CID 139917956
N-[2-[2-(2-hydroxyphenyl)phenyl]-4-(3-sulfanylphenyl)-1,3-oxazol-5-yl]pentanamide (PubChem CID 139917956) has the molecular formula C26H24N2O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is N-[2-[2-(2-hydroxyphenyl)phenyl]-4-(3-sulfanylphenyl)-1,3-oxazol-5-yl]pentanamide.
| Compound Name | N-[2-[2-(2-hydroxyphenyl)phenyl]-4-(3-sulfanylphenyl)-1,3-oxazol-5-yl]pentanamide |
|---|---|
| PubChem CID | 139917956 |
| Molecular Formula | C26H24N2O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | N-[2-[2-(2-hydroxyphenyl)phenyl]-4-(3-sulfanylphenyl)-1,3-oxazol-5-yl]pentanamide |
| SMILES | CCCCC(=O)Nc1oc(-c2ccccc2-c2ccccc2O)nc1-c1cccc(S)c1 |
| InChI | InChI=1S/C26H24N2O3S/c1-2-3-15-23(30)27-26-24(17-9-8-10-18(32)16-17)28-25(31-26)21-13-5-4-11-19(21)20-12-6-7-14-22(20)29/h4-14,16,29,32H,2-3,15H2,1H3,(H,27,30) |
| InChIKey | NPNHTKZVJQRHHI-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|