About methyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate
methyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate (PubChem CID 139918315) has the molecular formula C10H13ClO2
and a molecular weight of 200.66 g/mol. Its IUPAC name is methyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate.
Analyze methyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of methyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate (CID 139918315) is methyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for methyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for methyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate is CCC1=C(C(=O)OC)CCC(Cl)=C1.
What is the InChIKey of methyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate?
The InChIKey is WWPJNTCABMOYSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClO2/c1-3-7-6-8(11)4-5-9(7)10(12)13-2/h6H,3-5H2,1-2H3.
What are the key properties of methyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate?
methyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate has a molecular weight of 200.66 g/mol, XLogP of 2.78, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-chloro-2-ethylcyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 139918315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).