C13H13ClO3 — CID 15642723
ethyl 6-[(Z)-1-chloro-3-oxoprop-1-enyl]cyclohepta-1,3,5-triene-1-carboxylate (PubChem CID 15642723) has the molecular formula C13H13ClO3 and a molecular weight of 252.70 g/mol. Its IUPAC name is ethyl 6-[(Z)-1-chloro-3-oxoprop-1-enyl]cyclohepta-1,3,5-triene-1-carboxylate.
| Compound Name | ethyl 6-[(Z)-1-chloro-3-oxoprop-1-enyl]cyclohepta-1,3,5-triene-1-carboxylate |
|---|---|
| PubChem CID | 15642723 |
| Molecular Formula | C13H13ClO3 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | ethyl 6-[(Z)-1-chloro-3-oxoprop-1-enyl]cyclohepta-1,3,5-triene-1-carboxylate |
| SMILES | CCOC(=O)C1=CC=CC=C(/C(Cl)=C/C=O)C1 |
| InChI | InChI=1S/C13H13ClO3/c1-2-17-13(16)11-6-4-3-5-10(9-11)12(14)7-8-15/h3-8H,2,9H2,1H3/b12-7- |
| InChIKey | HOKIDWNCOZOQOP-GHXNOFRVSA-N |
| XLogP | 2.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|