About propan-2-yl 4-chloro-2-methylcyclohexa-1,3-diene-1-carboxylate
propan-2-yl 4-chloro-2-methylcyclohexa-1,3-diene-1-carboxylate (PubChem CID 139918253) has the molecular formula C11H15ClO2
and a molecular weight of 214.69 g/mol. Its IUPAC name is propan-2-yl 4-chloro-2-methylcyclohexa-1,3-diene-1-carboxylate.
Analyze propan-2-yl 4-chloro-2-methylcyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 4-chloro-2-methylcyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of propan-2-yl 4-chloro-2-methylcyclohexa-1,3-diene-1-carboxylate (CID 139918253) is propan-2-yl 4-chloro-2-methylcyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for propan-2-yl 4-chloro-2-methylcyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for propan-2-yl 4-chloro-2-methylcyclohexa-1,3-diene-1-carboxylate is CC1=C(C(=O)OC(C)C)CCC(Cl)=C1.
What is the InChIKey of propan-2-yl 4-chloro-2-methylcyclohexa-1,3-diene-1-carboxylate?
The InChIKey is NOURCNVBPPKGJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClO2/c1-7(2)14-11(13)10-5-4-9(12)6-8(10)3/h6-7H,4-5H2,1-3H3.
What are the key properties of propan-2-yl 4-chloro-2-methylcyclohexa-1,3-diene-1-carboxylate?
propan-2-yl 4-chloro-2-methylcyclohexa-1,3-diene-1-carboxylate has a molecular weight of 214.69 g/mol, XLogP of 3.17, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 4-chloro-2-methylcyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 139918253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).