C9H8Cl2O3 — CID 102288780
ethyl (2E)-2-(2,3-dichloro-4-oxocyclopent-2-en-1-ylidene)acetate (PubChem CID 102288780) has the molecular formula C9H8Cl2O3 and a molecular weight of 235.07 g/mol. Its IUPAC name is ethyl (2E)-2-(2,3-dichloro-4-oxocyclopent-2-en-1-ylidene)acetate.
| Compound Name | ethyl (2E)-2-(2,3-dichloro-4-oxocyclopent-2-en-1-ylidene)acetate |
|---|---|
| PubChem CID | 102288780 |
| Molecular Formula | C9H8Cl2O3 |
| Molecular Weight | 235.07 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | ethyl (2E)-2-(2,3-dichloro-4-oxocyclopent-2-en-1-ylidene)acetate |
| SMILES | CCOC(=O)/C=C1\CC(=O)C(Cl)=C1Cl |
| InChI | InChI=1S/C9H8Cl2O3/c1-2-14-7(13)4-5-3-6(12)9(11)8(5)10/h4H,2-3H2,1H3/b5-4+ |
| InChIKey | LMHCDENSWGKKIF-SNAWJCMRSA-N |
| XLogP | 2.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.07 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|