About methyl (2E)-2-(2,3-dichloro-4-oxocyclopent-2-en-1-ylidene)acetate
methyl (2E)-2-(2,3-dichloro-4-oxocyclopent-2-en-1-ylidene)acetate (PubChem CID 102288783) has the molecular formula C8H6Cl2O3
and a molecular weight of 221.04 g/mol. Its IUPAC name is methyl (2E)-2-(2,3-dichloro-4-oxocyclopent-2-en-1-ylidene)acetate.
Molecular Properties
| Compound Name | methyl (2E)-2-(2,3-dichloro-4-oxocyclopent-2-en-1-ylidene)acetate |
| PubChem CID | 102288783 |
| Molecular Formula | C8H6Cl2O3 |
| Molecular Weight | 221.04 g/mol |
| Exact Mass | 219.97 |
| IUPAC Name | methyl (2E)-2-(2,3-dichloro-4-oxocyclopent-2-en-1-ylidene)acetate |
| SMILES | COC(=O)/C=C1\CC(=O)C(Cl)=C1Cl |
| InChI | InChI=1S/C8H6Cl2O3/c1-13-6(12)3-4-2-5(11)8(10)7(4)9/h3H,2H2,1H3/b4-3+ |
| InChIKey | JATWSEPFLCUZJH-ONEGZZNKSA-N |
| XLogP | 1.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.04 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (2E)-2-(2,3-dichloro-4-oxocyclopent-2-en-1-ylidene)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2E)-2-(2,3-dichloro-4-oxocyclopent-2-en-1-ylidene)acetate?
The IUPAC name of methyl (2E)-2-(2,3-dichloro-4-oxocyclopent-2-en-1-ylidene)acetate (CID 102288783) is methyl (2E)-2-(2,3-dichloro-4-oxocyclopent-2-en-1-ylidene)acetate.
What is the SMILES notation for methyl (2E)-2-(2,3-dichloro-4-oxocyclopent-2-en-1-ylidene)acetate?
The canonical SMILES for methyl (2E)-2-(2,3-dichloro-4-oxocyclopent-2-en-1-ylidene)acetate is COC(=O)/C=C1\CC(=O)C(Cl)=C1Cl.
What is the InChIKey of methyl (2E)-2-(2,3-dichloro-4-oxocyclopent-2-en-1-ylidene)acetate?
The InChIKey is JATWSEPFLCUZJH-ONEGZZNKSA-N. The full InChI is InChI=1S/C8H6Cl2O3/c1-13-6(12)3-4-2-5(11)8(10)7(4)9/h3H,2H2,1H3/b4-3+.
What are the key properties of methyl (2E)-2-(2,3-dichloro-4-oxocyclopent-2-en-1-ylidene)acetate?
methyl (2E)-2-(2,3-dichloro-4-oxocyclopent-2-en-1-ylidene)acetate has a molecular weight of 221.04 g/mol, XLogP of 1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2E)-2-(2,3-dichloro-4-oxocyclopent-2-en-1-ylidene)acetate is sourced from PubChem (CID 102288783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).