C9H9ClO3 — CID 158130105
methyl 3-(2-chloroacetyl)cyclopenta-1,3-diene-1-carboxylate (PubChem CID 158130105) has the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. Its IUPAC name is methyl 3-(2-chloroacetyl)cyclopenta-1,3-diene-1-carboxylate.
| Compound Name | methyl 3-(2-chloroacetyl)cyclopenta-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 158130105 |
| Molecular Formula | C9H9ClO3 |
| Molecular Weight | 200.62 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | methyl 3-(2-chloroacetyl)cyclopenta-1,3-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC(C(=O)CCl)=CC1 |
| InChI | InChI=1S/C9H9ClO3/c1-13-9(12)7-3-2-6(4-7)8(11)5-10/h2,4H,3,5H2,1H3 |
| InChIKey | WOCIJYPBYCSYCA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.62 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|