C10H13ClO2 — CID 153399855
(3E,5Z)-1-chloro-3-(1-methoxyethenyl)hepta-3,5-dien-2-one (PubChem CID 153399855) has the molecular formula C10H13ClO2 and a molecular weight of 200.66 g/mol. Its IUPAC name is (3E,5Z)-1-chloro-3-(1-methoxyethenyl)hepta-3,5-dien-2-one.
| Compound Name | (3E,5Z)-1-chloro-3-(1-methoxyethenyl)hepta-3,5-dien-2-one |
|---|---|
| PubChem CID | 153399855 |
| Molecular Formula | C10H13ClO2 |
| Molecular Weight | 200.66 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | (3E,5Z)-1-chloro-3-(1-methoxyethenyl)hepta-3,5-dien-2-one |
| SMILES | C=C(OC)/C(=C\C=C/C)C(=O)CCl |
| InChI | InChI=1S/C10H13ClO2/c1-4-5-6-9(8(2)13-3)10(12)7-11/h4-6H,2,7H2,1,3H3/b5-4-,9-6+ |
| InChIKey | FUXFIBMMPQGBQR-KMOPYBJPSA-N |
| XLogP | 2.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.66 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|