C9H12O2 — CID 177208533
(3E)-3-(1-methoxyethenyl)hexa-3,5-dien-2-one (PubChem CID 177208533) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is (3E)-3-(1-methoxyethenyl)hexa-3,5-dien-2-one.
| Compound Name | (3E)-3-(1-methoxyethenyl)hexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 177208533 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (3E)-3-(1-methoxyethenyl)hexa-3,5-dien-2-one |
| SMILES | C=C/C=C(\C(=C)OC)C(C)=O |
| InChI | InChI=1S/C9H12O2/c1-5-6-9(7(2)10)8(3)11-4/h5-6H,1,3H2,2,4H3/b9-6- |
| InChIKey | RJBXAJXZZAZIJN-TWGQIWQCSA-N |
| XLogP | 1.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|