bis(2-methylprop-1-enyl) hydrogen phosphite

C8H15O3P — CID 139918667

IUPACbis(2-methylprop-1-enyl) hydrogen phosphite
SMILESCC(C)=COP(O)OC=C(C)C
InChIInChI=1S/C8H15O3P/c1-7(2)5-10-12(9)11-6-8(3)4/h5-6,9H,1-4H3
InChIKeyJYTVRCRDWTUYQM-UHFFFAOYSA-N
MW190.18 g/mol
LogP3.09
Rot. Bonds4

About bis(2-methylprop-1-enyl) hydrogen phosphite

bis(2-methylprop-1-enyl) hydrogen phosphite (PubChem CID 139918667) has the molecular formula C8H15O3P and a molecular weight of 190.18 g/mol. Its IUPAC name is bis(2-methylprop-1-enyl) hydrogen phosphite.

Molecular Properties

Compound Namebis(2-methylprop-1-enyl) hydrogen phosphite
PubChem CID139918667
Molecular FormulaC8H15O3P
Molecular Weight190.18 g/mol
Exact Mass190.08
IUPAC Namebis(2-methylprop-1-enyl) hydrogen phosphite
SMILESCC(C)=COP(O)OC=C(C)C
InChIInChI=1S/C8H15O3P/c1-7(2)5-10-12(9)11-6-8(3)4/h5-6,9H,1-4H3
InChIKeyJYTVRCRDWTUYQM-UHFFFAOYSA-N
XLogP3.09
TPSA38.69 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.18
LogP ≤ 53.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze bis(2-methylprop-1-enyl) hydrogen phosphite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bis(2-methylprop-1-enyl) hydrogen phosphite?
The IUPAC name of bis(2-methylprop-1-enyl) hydrogen phosphite (CID 139918667) is bis(2-methylprop-1-enyl) hydrogen phosphite.
What is the SMILES notation for bis(2-methylprop-1-enyl) hydrogen phosphite?
The canonical SMILES for bis(2-methylprop-1-enyl) hydrogen phosphite is CC(C)=COP(O)OC=C(C)C.
What is the InChIKey of bis(2-methylprop-1-enyl) hydrogen phosphite?
The InChIKey is JYTVRCRDWTUYQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15O3P/c1-7(2)5-10-12(9)11-6-8(3)4/h5-6,9H,1-4H3.
What are the key properties of bis(2-methylprop-1-enyl) hydrogen phosphite?
bis(2-methylprop-1-enyl) hydrogen phosphite has a molecular weight of 190.18 g/mol, XLogP of 3.09, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylprop-1-enyl) hydrogen phosphite is sourced from PubChem (CID 139918667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).