About bis(2-methylprop-1-enyl) hydrogen phosphite
bis(2-methylprop-1-enyl) hydrogen phosphite (PubChem CID 139918667) has the molecular formula C8H15O3P
and a molecular weight of 190.18 g/mol. Its IUPAC name is bis(2-methylprop-1-enyl) hydrogen phosphite.
Molecular Properties
| Compound Name | bis(2-methylprop-1-enyl) hydrogen phosphite |
| PubChem CID | 139918667 |
| Molecular Formula | C8H15O3P |
| Molecular Weight | 190.18 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | bis(2-methylprop-1-enyl) hydrogen phosphite |
| SMILES | CC(C)=COP(O)OC=C(C)C |
| InChI | InChI=1S/C8H15O3P/c1-7(2)5-10-12(9)11-6-8(3)4/h5-6,9H,1-4H3 |
| InChIKey | JYTVRCRDWTUYQM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.18 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylprop-1-enyl) hydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylprop-1-enyl) hydrogen phosphite?
The IUPAC name of bis(2-methylprop-1-enyl) hydrogen phosphite (CID 139918667) is bis(2-methylprop-1-enyl) hydrogen phosphite.
What is the SMILES notation for bis(2-methylprop-1-enyl) hydrogen phosphite?
The canonical SMILES for bis(2-methylprop-1-enyl) hydrogen phosphite is CC(C)=COP(O)OC=C(C)C.
What is the InChIKey of bis(2-methylprop-1-enyl) hydrogen phosphite?
The InChIKey is JYTVRCRDWTUYQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15O3P/c1-7(2)5-10-12(9)11-6-8(3)4/h5-6,9H,1-4H3.
What are the key properties of bis(2-methylprop-1-enyl) hydrogen phosphite?
bis(2-methylprop-1-enyl) hydrogen phosphite has a molecular weight of 190.18 g/mol, XLogP of 3.09, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylprop-1-enyl) hydrogen phosphite is sourced from PubChem (CID 139918667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).