About 2-methylprop-1-enyl methanimidate
2-methylprop-1-enyl methanimidate (PubChem CID 143570958) has the molecular formula C5H9NO
and a molecular weight of 99.13 g/mol. Its IUPAC name is 2-methylprop-1-enyl methanimidate.
Molecular Properties
| Compound Name | 2-methylprop-1-enyl methanimidate |
| PubChem CID | 143570958 |
| Molecular Formula | C5H9NO |
| Molecular Weight | 99.13 g/mol |
| Exact Mass | 99.07 |
| IUPAC Name | 2-methylprop-1-enyl methanimidate |
| SMILES | [H]/N=C/OC=C(C)C |
| InChI | InChI=1S/C5H9NO/c1-5(2)3-7-4-6/h3-4,6H,1-2H3/b6-4+ |
| InChIKey | QXOXYCWZMGVWFE-GQCTYLIASA-N |
| XLogP | 1.53 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.13 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-1-enyl methanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-1-enyl methanimidate?
The IUPAC name of 2-methylprop-1-enyl methanimidate (CID 143570958) is 2-methylprop-1-enyl methanimidate.
What is the SMILES notation for 2-methylprop-1-enyl methanimidate?
The canonical SMILES for 2-methylprop-1-enyl methanimidate is [H]/N=C/OC=C(C)C.
What is the InChIKey of 2-methylprop-1-enyl methanimidate?
The InChIKey is QXOXYCWZMGVWFE-GQCTYLIASA-N. The full InChI is InChI=1S/C5H9NO/c1-5(2)3-7-4-6/h3-4,6H,1-2H3/b6-4+.
What are the key properties of 2-methylprop-1-enyl methanimidate?
2-methylprop-1-enyl methanimidate has a molecular weight of 99.13 g/mol, XLogP of 1.53, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-1-enyl methanimidate is sourced from PubChem (CID 143570958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).