About 3-methylbut-2-enyl methanimidothioate
3-methylbut-2-enyl methanimidothioate (PubChem CID 155383674) has the molecular formula C6H11NS
and a molecular weight of 129.23 g/mol. Its IUPAC name is 3-methylbut-2-enyl methanimidothioate.
Molecular Properties
| Compound Name | 3-methylbut-2-enyl methanimidothioate |
| PubChem CID | 155383674 |
| Molecular Formula | C6H11NS |
| Molecular Weight | 129.23 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | 3-methylbut-2-enyl methanimidothioate |
| SMILES | [H]/N=C/SCC=C(C)C |
| InChI | InChI=1S/C6H11NS/c1-6(2)3-4-8-5-7/h3,5,7H,4H2,1-2H3/b7-5+ |
| InChIKey | WLCFODBCXDNVBQ-FNORWQNLSA-N |
| XLogP | 2.29 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-2-enyl methanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-2-enyl methanimidothioate?
The IUPAC name of 3-methylbut-2-enyl methanimidothioate (CID 155383674) is 3-methylbut-2-enyl methanimidothioate.
What is the SMILES notation for 3-methylbut-2-enyl methanimidothioate?
The canonical SMILES for 3-methylbut-2-enyl methanimidothioate is [H]/N=C/SCC=C(C)C.
What is the InChIKey of 3-methylbut-2-enyl methanimidothioate?
The InChIKey is WLCFODBCXDNVBQ-FNORWQNLSA-N. The full InChI is InChI=1S/C6H11NS/c1-6(2)3-4-8-5-7/h3,5,7H,4H2,1-2H3/b7-5+.
What are the key properties of 3-methylbut-2-enyl methanimidothioate?
3-methylbut-2-enyl methanimidothioate has a molecular weight of 129.23 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-2-enyl methanimidothioate is sourced from PubChem (CID 155383674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).