C16H12FNO4 — CID 139921370
4-(3,5-dimethoxyphenyl)-5-fluoroisoindole-1,3-dione (PubChem CID 139921370) has the molecular formula C16H12FNO4 and a molecular weight of 301.27 g/mol. Its IUPAC name is 4-(3,5-dimethoxyphenyl)-5-fluoroisoindole-1,3-dione.
| Compound Name | 4-(3,5-dimethoxyphenyl)-5-fluoroisoindole-1,3-dione |
|---|---|
| PubChem CID | 139921370 |
| Molecular Formula | C16H12FNO4 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 4-(3,5-dimethoxyphenyl)-5-fluoroisoindole-1,3-dione |
| SMILES | COc1cc(OC)cc(-c2c(F)ccc3c2C(=O)NC3=O)c1 |
| InChI | InChI=1S/C16H12FNO4/c1-21-9-5-8(6-10(7-9)22-2)13-12(17)4-3-11-14(13)16(20)18-15(11)19/h3-7H,1-2H3,(H,18,19,20) |
| InChIKey | HBSJFSVLNHRTFQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|