C11H13N5 — CID 139921602
1-(2,3-dihydro-1H-tetrazol-5-ylmethyl)-2-methylindole (PubChem CID 139921602) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-tetrazol-5-ylmethyl)-2-methylindole.
| Compound Name | 1-(2,3-dihydro-1H-tetrazol-5-ylmethyl)-2-methylindole |
|---|---|
| PubChem CID | 139921602 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 1-(2,3-dihydro-1H-tetrazol-5-ylmethyl)-2-methylindole |
| SMILES | Cc1cc2ccccc2n1CC1=NNNN1 |
| InChI | InChI=1S/C11H13N5/c1-8-6-9-4-2-3-5-10(9)16(8)7-11-12-14-15-13-11/h2-6,14-15H,7H2,1H3,(H,12,13) |
| InChIKey | WQUSTKQGJOPFIM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 53.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |