C26H34N2O5 — CID 139921623
2-[[(7R)-7-[[(2R)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]-N,N-dimethylacetamide (PubChem CID 139921623) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is 2-[[(7R)-7-[[(2R)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]-N,N-dimethylacetamide.
| Compound Name | 2-[[(7R)-7-[[(2R)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 139921623 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 2-[[(7R)-7-[[(2R)-2-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-hydroxyethyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)COc1ccc2c(c1)C[C@H](NC[C@H](O)c1ccc3c(c1)COC(C)(C)O3)CC2 |
| InChI | InChI=1S/C26H34N2O5/c1-26(2)32-15-20-11-18(7-10-24(20)33-26)23(29)14-27-21-8-5-17-6-9-22(13-19(17)12-21)31-16-25(30)28(3)4/h6-7,9-11,13,21,23,27,29H,5,8,12,14-16H2,1-4H3/t21-,23+/m1/s1 |
| InChIKey | SLNQFDYIBZHQRK-GGAORHGYSA-N |
| XLogP | 2.98 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |