C22H26ClN3O5 — CID 67685524
ethyl 2-[[(7S)-7-[[(2S)-2-(2,1,3-benzoxadiazol-5-yl)-2-hydroxyethyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]acetate;hydrochloride (PubChem CID 67685524) has the molecular formula C22H26ClN3O5 and a molecular weight of 447.92 g/mol. Its IUPAC name is ethyl 2-[[(7S)-7-[[(2S)-2-(2,1,3-benzoxadiazol-5-yl)-2-hydroxyethyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]acetate;hydrochloride.
| Compound Name | ethyl 2-[[(7S)-7-[[(2S)-2-(2,1,3-benzoxadiazol-5-yl)-2-hydroxyethyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]acetate;hydrochloride |
|---|---|
| PubChem CID | 67685524 |
| Molecular Formula | C22H26ClN3O5 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | ethyl 2-[[(7S)-7-[[(2S)-2-(2,1,3-benzoxadiazol-5-yl)-2-hydroxyethyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]acetate;hydrochloride |
| SMILES | CCOC(=O)COc1ccc2c(c1)C[C@@H](NC[C@@H](O)c1ccc3nonc3c1)CC2.Cl |
| InChI | InChI=1S/C22H25N3O5.ClH/c1-2-28-22(27)13-29-18-7-4-14-3-6-17(9-16(14)10-18)23-12-21(26)15-5-8-19-20(11-15)25-30-24-19;/h4-5,7-8,10-11,17,21,23,26H,2-3,6,9,12-13H2,1H3;1H/t17-,21+;/m0./s1 |
| InChIKey | XRCRKUJZJPNPSB-CQVJSGDESA-N |
| XLogP | 2.77 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |